C20H40N2O5S — CID 178135504
tert-butyl N-[2-[2-[2-[(3,5,5-trimethyl-3-sulfanylhexanoyl)amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 178135504) has the molecular formula C20H40N2O5S and a molecular weight of 420.62 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[(3,5,5-trimethyl-3-sulfanylhexanoyl)amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[(3,5,5-trimethyl-3-sulfanylhexanoyl)amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 178135504 |
| Molecular Formula | C20H40N2O5S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[(3,5,5-trimethyl-3-sulfanylhexanoyl)amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)CC(C)(S)CC(=O)NCCOCCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N2O5S/c1-18(2,3)15-20(7,28)14-16(23)21-8-10-25-12-13-26-11-9-22-17(24)27-19(4,5)6/h28H,8-15H2,1-7H3,(H,21,23)(H,22,24) |
| InChIKey | XEUFNLVZGIVNBE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|