C35H52N4O2 — CID 178143436
tert-butyl (2S)-2-[3-(4-benzyl-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepin-2-yl)-4-(benzylamino)butyl]pyrrolidine-1-carboxylate (PubChem CID 178143436) has the molecular formula C35H52N4O2 and a molecular weight of 560.83 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(4-benzyl-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepin-2-yl)-4-(benzylamino)butyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-(4-benzyl-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepin-2-yl)-4-(benzylamino)butyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178143436 |
| Molecular Formula | C35H52N4O2 |
| Molecular Weight | 560.83 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | tert-butyl (2S)-2-[3-(4-benzyl-2,3,3a,5,6,7,8,8a-octahydro-1H-pyrrolo[3,2-b]azepin-2-yl)-4-(benzylamino)butyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CCC(CNCc1ccccc1)C1CC2C(CCCCN2Cc2ccccc2)N1 |
| InChI | InChI=1S/C35H52N4O2/c1-35(2,3)41-34(40)39-22-12-17-30(39)20-19-29(25-36-24-27-13-6-4-7-14-27)32-23-33-31(37-32)18-10-11-21-38(33)26-28-15-8-5-9-16-28/h4-9,13-16,29-33,36-37H,10-12,17-26H2,1-3H3/t29?,30-,31?,32?,33?/m1/s1 |
| InChIKey | WEDRODHBTHXNPD-MNWUWFKBSA-N |
| XLogP | 6.36 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.83 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |