C33H30FN5O4 — CID 178147766
tert-butyl 3-[4-[2-(2-fluoro-6-nitrophenyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]pyrrolidine-1-carboxylate (PubChem CID 178147766) has the molecular formula C33H30FN5O4 and a molecular weight of 579.63 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-(2-fluoro-6-nitrophenyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[2-(2-fluoro-6-nitrophenyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178147766 |
| Molecular Formula | C33H30FN5O4 |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | tert-butyl 3-[4-[2-(2-fluoro-6-nitrophenyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(-n3c(-c4c(F)cccc4[N+](=O)[O-])nc4ccc(-c5ccccc5)nc43)cc2)C1 |
| InChI | InChI=1S/C33H30FN5O4/c1-33(2,3)43-32(40)37-19-18-23(20-37)21-12-14-24(15-13-21)38-30-27(17-16-26(35-30)22-8-5-4-6-9-22)36-31(38)29-25(34)10-7-11-28(29)39(41)42/h4-17,23H,18-20H2,1-3H3 |
| InChIKey | JRRGGOMHZMLCBT-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|