C26H31FN5O4+ — CID 178149265
3-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-2-N,5-dimethylpyridine-2,6-dicarboxamide (PubChem CID 178149265) has the molecular formula C26H31FN5O4+ and a molecular weight of 496.56 g/mol. Its IUPAC name is 3-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-2-N,5-dimethylpyridine-2,6-dicarboxamide.
| Compound Name | 3-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-2-N,5-dimethylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 178149265 |
| Molecular Formula | C26H31FN5O4+ |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 3-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-2-N,5-dimethylpyridine-2,6-dicarboxamide |
| SMILES | C=CC(=O)[N+]1=C(C)CN(C[C@@H](Oc2cc(C)c(C(N)=O)nc2C(=O)NC)c2ccc(C)c(F)c2)CC1 |
| InChI | InChI=1S/C26H30FN5O4/c1-6-22(33)32-10-9-31(13-17(32)4)14-21(18-8-7-15(2)19(27)12-18)36-20-11-16(3)23(25(28)34)30-24(20)26(35)29-5/h6-8,11-12,21H,1,9-10,13-14H2,2-5H3,(H2-,28,29,34,35)/p+1/t21-/m1/s1 |
| InChIKey | SIPVRZPUIIAPSA-OAQYLSRUSA-O |
| XLogP | 1.92 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|