C31H33FN3O3+ — CID 178150232
4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-2-methyl-N-phenylbenzamide (PubChem CID 178150232) has the molecular formula C31H33FN3O3+ and a molecular weight of 514.62 g/mol. Its IUPAC name is 4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-2-methyl-N-phenylbenzamide.
| Compound Name | 4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-2-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 178150232 |
| Molecular Formula | C31H33FN3O3+ |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 4-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]-2-methyl-N-phenylbenzamide |
| SMILES | C=CC(=O)[N+]1=C(C)CN(C[C@@H](Oc2ccc(C(=O)Nc3ccccc3)c(C)c2)c2ccc(C)c(F)c2)CC1 |
| InChI | InChI=1S/C31H32FN3O3/c1-5-30(36)35-16-15-34(19-23(35)4)20-29(24-12-11-21(2)28(32)18-24)38-26-13-14-27(22(3)17-26)31(37)33-25-9-7-6-8-10-25/h5-14,17-18,29H,1,15-16,19-20H2,2-4H3/p+1/t29-/m1/s1 |
| InChIKey | CZRNLAMGINFQNU-GDLZYMKVSA-O |
| XLogP | 5.32 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|