C22H26FN4O4S+ — CID 178150239
6-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]pyridine-3-sulfonamide (PubChem CID 178150239) has the molecular formula C22H26FN4O4S+ and a molecular weight of 461.54 g/mol. Its IUPAC name is 6-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]pyridine-3-sulfonamide.
| Compound Name | 6-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 178150239 |
| Molecular Formula | C22H26FN4O4S+ |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 6-[(1S)-1-(3-fluoro-4-methylphenyl)-2-(6-methyl-1-prop-2-enoyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)ethoxy]pyridine-3-sulfonamide |
| SMILES | C=CC(=O)[N+]1=C(C)CN(C[C@@H](Oc2ccc(S(N)(=O)=O)cn2)c2ccc(C)c(F)c2)CC1 |
| InChI | InChI=1S/C22H26FN4O4S/c1-4-22(28)27-10-9-26(13-16(27)3)14-20(17-6-5-15(2)19(23)11-17)31-21-8-7-18(12-25-21)32(24,29)30/h4-8,11-12,20H,1,9-10,13-14H2,2-3H3,(H2,24,29,30)/q+1/t20-/m1/s1 |
| InChIKey | DNIYWIPVHCMIMD-HXUWFJFHSA-N |
| XLogP | 1.80 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|