C21H30FN2O3+ — CID 178150512
tert-butyl 4-[2-[(S)-(3-fluoro-4-methylphenyl)-hydroxymethyl]prop-2-enyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate (PubChem CID 178150512) has the molecular formula C21H30FN2O3+ and a molecular weight of 377.48 g/mol. Its IUPAC name is tert-butyl 4-[2-[(S)-(3-fluoro-4-methylphenyl)-hydroxymethyl]prop-2-enyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(S)-(3-fluoro-4-methylphenyl)-hydroxymethyl]prop-2-enyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 178150512 |
| Molecular Formula | C21H30FN2O3+ |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | tert-butyl 4-[2-[(S)-(3-fluoro-4-methylphenyl)-hydroxymethyl]prop-2-enyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate |
| SMILES | C=C(CN1CC[N+](C(=O)OC(C)(C)C)=C(C)C1)[C@@H](O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C21H30FN2O3/c1-14-7-8-17(11-18(14)22)19(25)15(2)12-23-9-10-24(16(3)13-23)20(26)27-21(4,5)6/h7-8,11,19,25H,2,9-10,12-13H2,1,3-6H3/q+1/t19-/m1/s1 |
| InChIKey | DLUNJOAGEJZKHK-LJQANCHMSA-N |
| XLogP | 3.45 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|