C23H35N2O3+ — CID 178151496
tert-butyl 4-[2-(3,4-dimethylphenyl)-2-[(E)-prop-1-enoxy]ethyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate (PubChem CID 178151496) has the molecular formula C23H35N2O3+ and a molecular weight of 387.54 g/mol. Its IUPAC name is tert-butyl 4-[2-(3,4-dimethylphenyl)-2-[(E)-prop-1-enoxy]ethyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3,4-dimethylphenyl)-2-[(E)-prop-1-enoxy]ethyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 178151496 |
| Molecular Formula | C23H35N2O3+ |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | tert-butyl 4-[2-(3,4-dimethylphenyl)-2-[(E)-prop-1-enoxy]ethyl]-6-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-carboxylate |
| SMILES | C/C=C/OC(CN1CC[N+](C(=O)OC(C)(C)C)=C(C)C1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C23H35N2O3/c1-8-13-27-21(20-10-9-17(2)18(3)14-20)16-24-11-12-25(19(4)15-24)22(26)28-23(5,6)7/h8-10,13-14,21H,11-12,15-16H2,1-7H3/q+1/b13-8+ |
| InChIKey | RUULIPAPZOKTBT-MDWZMJQESA-N |
| XLogP | 4.62 |
| TPSA | 41.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|