C23H31N3O6 — CID 178156678
(2S)-6-amino-2-tert-butyl-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoic acid (PubChem CID 178156678) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is (2S)-6-amino-2-tert-butyl-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-tert-butyl-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 178156678 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (2S)-6-amino-2-tert-butyl-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoic acid |
| SMILES | CCOc1c(Nc2ccc(C(=O)N[C@](CCCCN)(C(=O)O)C(C)(C)C)cc2)c(=O)c1=O |
| InChI | InChI=1S/C23H31N3O6/c1-5-32-19-16(17(27)18(19)28)25-15-10-8-14(9-11-15)20(29)26-23(21(30)31,22(2,3)4)12-6-7-13-24/h8-11,25H,5-7,12-13,24H2,1-4H3,(H,26,29)(H,30,31)/t23-/m1/s1 |
| InChIKey | IVTKAAIYYYKKHV-HSZRJFAPSA-N |
| XLogP | 2.15 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|