C26H28N4O7 — CID 178156715
(2S)-6-[(4-aminobenzoyl)amino]-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoic acid (PubChem CID 178156715) has the molecular formula C26H28N4O7 and a molecular weight of 508.53 g/mol. Its IUPAC name is (2S)-6-[(4-aminobenzoyl)amino]-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-[(4-aminobenzoyl)amino]-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 178156715 |
| Molecular Formula | C26H28N4O7 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (2S)-6-[(4-aminobenzoyl)amino]-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoic acid |
| SMILES | CCOc1c(Nc2ccc(C(=O)N[C@@H](CCCCNC(=O)c3ccc(N)cc3)C(=O)O)cc2)c(=O)c1=O |
| InChI | InChI=1S/C26H28N4O7/c1-2-37-23-20(21(31)22(23)32)29-18-12-8-16(9-13-18)25(34)30-19(26(35)36)5-3-4-14-28-24(33)15-6-10-17(27)11-7-15/h6-13,19,29H,2-5,14,27H2,1H3,(H,28,33)(H,30,34)(H,35,36)/t19-/m0/s1 |
| InChIKey | YIZBXIIVOIZJLK-IBGZPJMESA-N |
| XLogP | 1.79 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|