C30H36N4O7 — CID 178156672
tert-butyl (2S)-6-[(4-aminobenzoyl)amino]-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoate (PubChem CID 178156672) has the molecular formula C30H36N4O7 and a molecular weight of 564.64 g/mol. Its IUPAC name is tert-butyl (2S)-6-[(4-aminobenzoyl)amino]-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoate.
| Compound Name | tert-butyl (2S)-6-[(4-aminobenzoyl)amino]-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 178156672 |
| Molecular Formula | C30H36N4O7 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | tert-butyl (2S)-6-[(4-aminobenzoyl)amino]-2-[[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]benzoyl]amino]hexanoate |
| SMILES | CCOc1c(Nc2ccc(C(=O)N[C@@H](CCCCNC(=O)c3ccc(N)cc3)C(=O)OC(C)(C)C)cc2)c(=O)c1=O |
| InChI | InChI=1S/C30H36N4O7/c1-5-40-26-23(24(35)25(26)36)33-21-15-11-19(12-16-21)28(38)34-22(29(39)41-30(2,3)4)8-6-7-17-32-27(37)18-9-13-20(31)14-10-18/h9-16,22,33H,5-8,17,31H2,1-4H3,(H,32,37)(H,34,38)/t22-/m0/s1 |
| InChIKey | JYLHNVVIPBQKHJ-QFIPXVFZSA-N |
| XLogP | 3.05 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|