C19H26N8 — CID 178158762
(Z)-N-(1-aminoethylidene)-4-[1-ethyl-3-[2-(1-methylpyrazol-4-yl)cyclopropyl]pyrazol-5-yl]-4-imino-2-methylbut-2-enimidamide (PubChem CID 178158762) has the molecular formula C19H26N8 and a molecular weight of 366.47 g/mol. Its IUPAC name is (Z)-N-(1-aminoethylidene)-4-[1-ethyl-3-[2-(1-methylpyrazol-4-yl)cyclopropyl]pyrazol-5-yl]-4-imino-2-methylbut-2-enimidamide.
| Compound Name | (Z)-N-(1-aminoethylidene)-4-[1-ethyl-3-[2-(1-methylpyrazol-4-yl)cyclopropyl]pyrazol-5-yl]-4-imino-2-methylbut-2-enimidamide |
|---|---|
| PubChem CID | 178158762 |
| Molecular Formula | C19H26N8 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (Z)-N-(1-aminoethylidene)-4-[1-ethyl-3-[2-(1-methylpyrazol-4-yl)cyclopropyl]pyrazol-5-yl]-4-imino-2-methylbut-2-enimidamide |
| SMILES | [H]/N=C(\N=C(/C)N)C(/C)=C\C(=N\[H])c1cc(C2CC2c2cnn(C)c2)nn1CC |
| InChI | InChI=1S/C19H26N8/c1-5-27-18(16(21)6-11(2)19(22)24-12(3)20)8-17(25-27)15-7-14(15)13-9-23-26(4)10-13/h6,8-10,14-15,21H,5,7H2,1-4H3,(H3,20,22,24)/b11-6-,21-16- |
| InChIKey | JQBGLPZQQOFUNH-AZWCISCYSA-N |
| XLogP | 2.58 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|