C20H24KN6S — CID 178159103
CID 178159103 (PubChem CID 178159103) has the molecular formula C20H24KN6S and a molecular weight of 419.62 g/mol.
| Compound Name | CID 178159103 |
|---|---|
| PubChem CID | 178159103 |
| Molecular Formula | C20H24KN6S |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | — |
| SMILES | CC.Cc1snc2ccc(-c3cc([C@H]4C[C@@H]4c4cnn(C)c4)nn3C)nc12.[K] |
| InChI | InChI=1S/C18H18N6S.C2H6.K/c1-10-18-15(22-25-10)5-4-14(20-18)17-7-16(21-24(17)3)13-6-12(13)11-8-19-23(2)9-11;1-2;/h4-5,7-9,12-13H,6H2,1-3H3;1-2H3;/t12-,13+;;/m1../s1 |
| InChIKey | PCKKGTZGUIJFJP-VAALMUBNSA-N |
| XLogP | 4.05 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |