C18H22N8 — CID 178159075
2-ethanimidoyl-6-[1-ethyl-3-[2-(1-methylpyrazol-4-yl)cyclopropyl]pyrazol-5-yl]pyridazin-3-imine (PubChem CID 178159075) has the molecular formula C18H22N8 and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-ethanimidoyl-6-[1-ethyl-3-[2-(1-methylpyrazol-4-yl)cyclopropyl]pyrazol-5-yl]pyridazin-3-imine.
| Compound Name | 2-ethanimidoyl-6-[1-ethyl-3-[2-(1-methylpyrazol-4-yl)cyclopropyl]pyrazol-5-yl]pyridazin-3-imine |
|---|---|
| PubChem CID | 178159075 |
| Molecular Formula | C18H22N8 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-ethanimidoyl-6-[1-ethyl-3-[2-(1-methylpyrazol-4-yl)cyclopropyl]pyrazol-5-yl]pyridazin-3-imine |
| SMILES | [H]/N=C(\C)n1nc(-c2cc(C3CC3c3cnn(C)c3)nn2CC)cc/c1=N\[H] |
| InChI | InChI=1S/C18H22N8/c1-4-25-17(15-5-6-18(20)26(23-15)11(2)19)8-16(22-25)14-7-13(14)12-9-21-24(3)10-12/h5-6,8-10,13-14,19-20H,4,7H2,1-3H3/b19-11+,20-18+ |
| InChIKey | AARWHJBTLOXMDH-DSTXHIGZSA-N |
| XLogP | 2.10 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|