C19H24N8 — CID 178159092
2-ethanimidoyl-6-[3-[2-(1-ethylpyrazol-4-yl)cyclopropyl]-1-methylpyrazol-5-yl]-4-methylpyridazin-3-imine (PubChem CID 178159092) has the molecular formula C19H24N8 and a molecular weight of 364.46 g/mol. Its IUPAC name is 2-ethanimidoyl-6-[3-[2-(1-ethylpyrazol-4-yl)cyclopropyl]-1-methylpyrazol-5-yl]-4-methylpyridazin-3-imine.
| Compound Name | 2-ethanimidoyl-6-[3-[2-(1-ethylpyrazol-4-yl)cyclopropyl]-1-methylpyrazol-5-yl]-4-methylpyridazin-3-imine |
|---|---|
| PubChem CID | 178159092 |
| Molecular Formula | C19H24N8 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 2-ethanimidoyl-6-[3-[2-(1-ethylpyrazol-4-yl)cyclopropyl]-1-methylpyrazol-5-yl]-4-methylpyridazin-3-imine |
| SMILES | [H]/N=C(\C)n1nc(-c2cc(C3CC3c3cnn(CC)c3)nn2C)cc(C)/c1=N\[H] |
| InChI | InChI=1S/C19H24N8/c1-5-26-10-13(9-22-26)14-7-15(14)16-8-18(25(4)23-16)17-6-11(2)19(21)27(24-17)12(3)20/h6,8-10,14-15,20-21H,5,7H2,1-4H3/b20-12+,21-19+ |
| InChIKey | NUTDYUJHGJRKIM-IHBSRWQLSA-N |
| XLogP | 2.40 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|