C20H24FN8+ — CID 178159061
2-ethanimidoyl-6-[3-[2-[6-(ethylamino)-5-fluoro-3-pyridinyl]cyclopropyl]-1-methylpyrazol-5-yl]pyridazin-2-ium-3-amine (PubChem CID 178159061) has the molecular formula C20H24FN8+ and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-ethanimidoyl-6-[3-[2-[6-(ethylamino)-5-fluoro-3-pyridinyl]cyclopropyl]-1-methylpyrazol-5-yl]pyridazin-2-ium-3-amine.
| Compound Name | 2-ethanimidoyl-6-[3-[2-[6-(ethylamino)-5-fluoro-3-pyridinyl]cyclopropyl]-1-methylpyrazol-5-yl]pyridazin-2-ium-3-amine |
|---|---|
| PubChem CID | 178159061 |
| Molecular Formula | C20H24FN8+ |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-ethanimidoyl-6-[3-[2-[6-(ethylamino)-5-fluoro-3-pyridinyl]cyclopropyl]-1-methylpyrazol-5-yl]pyridazin-2-ium-3-amine |
| SMILES | [H]/N=C(\C)[n+]1nc(-c2cc(C3CC3c3cnc(NCC)c(F)c3)nn2C)ccc1N |
| InChI | InChI=1S/C20H23FN8/c1-4-24-20-15(21)7-12(10-25-20)13-8-14(13)17-9-18(28(3)26-17)16-5-6-19(23)29(27-16)11(2)22/h5-7,9-10,13-14,22-23H,4,8H2,1-3H3,(H,24,25)/p+1/b22-11+ |
| InChIKey | KDXVNAGKDNPSKC-SSDVNMTOSA-O |
| XLogP | 2.43 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|