C10H14FN5 — CID 139386937
[5-(2,3-dimethyl-3,4-dihydropyrazol-4-yl)-3-fluoro-2-pyridinyl]hydrazine (PubChem CID 139386937) has the molecular formula C10H14FN5 and a molecular weight of 223.25 g/mol. Its IUPAC name is [5-(2,3-dimethyl-3,4-dihydropyrazol-4-yl)-3-fluoro-2-pyridinyl]hydrazine.
| Compound Name | [5-(2,3-dimethyl-3,4-dihydropyrazol-4-yl)-3-fluoro-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 139386937 |
| Molecular Formula | C10H14FN5 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | [5-(2,3-dimethyl-3,4-dihydropyrazol-4-yl)-3-fluoro-2-pyridinyl]hydrazine |
| SMILES | CC1C(c2cnc(NN)c(F)c2)C=NN1C |
| InChI | InChI=1S/C10H14FN5/c1-6-8(5-14-16(6)2)7-3-9(11)10(15-12)13-4-7/h3-6,8H,12H2,1-2H3,(H,13,15) |
| InChIKey | GHQKGUAAZRIAEF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|