C63H61N — CID 178165817
2',7'-ditert-butyl-N-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)spiro[1,9a-dihydrofluorene-9,9'-fluorene]-4'-amine (PubChem CID 178165817) has the molecular formula C63H61N and a molecular weight of 832.19 g/mol. Its IUPAC name is 2',7'-ditert-butyl-N-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)spiro[1,9a-dihydrofluorene-9,9'-fluorene]-4'-amine.
| Compound Name | 2',7'-ditert-butyl-N-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)spiro[1,9a-dihydrofluorene-9,9'-fluorene]-4'-amine |
|---|---|
| PubChem CID | 178165817 |
| Molecular Formula | C63H61N |
| Molecular Weight | 832.19 g/mol |
| Exact Mass | 831.48 |
| IUPAC Name | 2',7'-ditert-butyl-N-(9,9-dimethyl-2,3-dihydrofluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)spiro[1,9a-dihydrofluorene-9,9'-fluorene]-4'-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3ccccc3C3=CC=CCC31)c1cc(C(C)(C)C)cc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)C3C=C4C(=CC3)c3ccccc3C4(C)C)c1-2 |
| InChI | InChI=1S/C63H61N/c1-59(2,3)38-27-30-48-55(33-38)63(51-25-17-13-21-44(51)45-22-14-18-26-52(45)63)56-34-39(60(4,5)6)35-57(58(48)56)64(40-28-31-46-42-19-11-15-23-49(42)61(7,8)53(46)36-40)41-29-32-47-43-20-12-16-24-50(43)62(9,10)54(47)37-41/h11-25,27-28,30-37,41,52H,26,29H2,1-10H3 |
| InChIKey | KIYOYJJCWLHFDI-UHFFFAOYSA-N |
| XLogP | 16.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.19 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |