C26H33NO2 — CID 178167067
1-benzhydryl-3-(2,4-diethoxy-3-methylpenta-1,4-dien-3-yl)azetidine (PubChem CID 178167067) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-benzhydryl-3-(2,4-diethoxy-3-methylpenta-1,4-dien-3-yl)azetidine.
| Compound Name | 1-benzhydryl-3-(2,4-diethoxy-3-methylpenta-1,4-dien-3-yl)azetidine |
|---|---|
| PubChem CID | 178167067 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-benzhydryl-3-(2,4-diethoxy-3-methylpenta-1,4-dien-3-yl)azetidine |
| SMILES | C=C(OCC)C(C)(C(=C)OCC)C1CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H33NO2/c1-6-28-20(3)26(5,21(4)29-7-2)24-18-27(19-24)25(22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,24-25H,3-4,6-7,18-19H2,1-2,5H3 |
| InChIKey | NTVKCEYQRYPCKR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|