C24H29N3O5 — CID 178167496
(3aR,6aS)-1-[(2S)-2-(8-hydroxy-4-prop-2-enoyl-4,7-diazaspiro[2.5]octan-7-yl)-3-phenylpropanoyl]-3,3a,4,6a-tetrahydro-2H-furo[3,4-b]pyrrol-6-one (PubChem CID 178167496) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is (3aR,6aS)-1-[(2S)-2-(8-hydroxy-4-prop-2-enoyl-4,7-diazaspiro[2.5]octan-7-yl)-3-phenylpropanoyl]-3,3a,4,6a-tetrahydro-2H-furo[3,4-b]pyrrol-6-one.
| Compound Name | (3aR,6aS)-1-[(2S)-2-(8-hydroxy-4-prop-2-enoyl-4,7-diazaspiro[2.5]octan-7-yl)-3-phenylpropanoyl]-3,3a,4,6a-tetrahydro-2H-furo[3,4-b]pyrrol-6-one |
|---|---|
| PubChem CID | 178167496 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (3aR,6aS)-1-[(2S)-2-(8-hydroxy-4-prop-2-enoyl-4,7-diazaspiro[2.5]octan-7-yl)-3-phenylpropanoyl]-3,3a,4,6a-tetrahydro-2H-furo[3,4-b]pyrrol-6-one |
| SMILES | C=CC(=O)N1CCN(C(Cc2ccccc2)C(=O)N2CC[C@H]3COC(=O)[C@H]32)C(O)C12CC2 |
| InChI | InChI=1S/C24H29N3O5/c1-2-19(28)27-13-12-25(23(31)24(27)9-10-24)18(14-16-6-4-3-5-7-16)21(29)26-11-8-17-15-32-22(30)20(17)26/h2-7,17-18,20,23,31H,1,8-15H2/t17-,18?,20-,23?/m0/s1 |
| InChIKey | SAUUJUPBGQIKPE-YMGHUDQASA-N |
| XLogP | 0.55 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|