C21H20F3N3O7S — CID 178167998
methyl (2S)-2-[[1-[(4-nitrophenyl)sulfonylamino]cyclopropanecarbonyl]amino]-3-[3-(trifluoromethyl)phenyl]propanoate (PubChem CID 178167998) has the molecular formula C21H20F3N3O7S and a molecular weight of 515.47 g/mol. Its IUPAC name is methyl (2S)-2-[[1-[(4-nitrophenyl)sulfonylamino]cyclopropanecarbonyl]amino]-3-[3-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl (2S)-2-[[1-[(4-nitrophenyl)sulfonylamino]cyclopropanecarbonyl]amino]-3-[3-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 178167998 |
| Molecular Formula | C21H20F3N3O7S |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | methyl (2S)-2-[[1-[(4-nitrophenyl)sulfonylamino]cyclopropanecarbonyl]amino]-3-[3-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1cccc(C(F)(F)F)c1)NC(=O)C1(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H20F3N3O7S/c1-34-18(28)17(12-13-3-2-4-14(11-13)21(22,23)24)25-19(29)20(9-10-20)26-35(32,33)16-7-5-15(6-8-16)27(30)31/h2-8,11,17,26H,9-10,12H2,1H3,(H,25,29)/t17-/m0/s1 |
| InChIKey | UEGJDXNTTPPEIC-KRWDZBQOSA-N |
| XLogP | 2.33 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|