C14H27N3 — CID 178170713
ethane;(2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine (PubChem CID 178170713) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;(2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine.
| Compound Name | ethane;(2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine |
|---|---|
| PubChem CID | 178170713 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | ethane;(2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine |
| SMILES | CC.[H]/N=C(\C=C(\C)N)C(=C)N1CCC(CC)C1 |
| InChI | InChI=1S/C12H21N3.C2H6/c1-4-11-5-6-15(8-11)10(3)12(14)7-9(2)13;1-2/h7,11,14H,3-6,8,13H2,1-2H3;1-2H3/b9-7-,14-12+; |
| InChIKey | MCVBCQHJOJMWKZ-BLSBZKRASA-N |
| XLogP | 3.14 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|