C29H30LiN5O3-2 — CID 178177916
lithium;N-(4-amino-2,3-dimethylquinolin-6-yl)-2-[[di(ethyl)amino]methyl]benzamide;nitrobenzene (PubChem CID 178177916) has the molecular formula C29H30LiN5O3-2 and a molecular weight of 503.53 g/mol. Its IUPAC name is lithium;N-(4-amino-2,3-dimethylquinolin-6-yl)-2-[[di(ethyl)amino]methyl]benzamide;nitrobenzene.
| Compound Name | lithium;N-(4-amino-2,3-dimethylquinolin-6-yl)-2-[[di(ethyl)amino]methyl]benzamide;nitrobenzene |
|---|---|
| PubChem CID | 178177916 |
| Molecular Formula | C29H30LiN5O3-2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | lithium;N-(4-amino-2,3-dimethylquinolin-6-yl)-2-[[di(ethyl)amino]methyl]benzamide;nitrobenzene |
| SMILES | O=[N+]([O-])c1[c-]cccc1.[CH2-]CN(C[CH2-])Cc1ccccc1C(=O)Nc1ccc2nc(C)c(C)c(N)c2c1.[Li+] |
| InChI | InChI=1S/C23H26N4O.C6H4NO2.Li/c1-5-27(6-2)14-17-9-7-8-10-19(17)23(28)26-18-11-12-21-20(13-18)22(24)15(3)16(4)25-21;8-7(9)6-4-2-1-3-5-6;/h7-13H,1-2,5-6,14H2,3-4H3,(H2,24,25)(H,26,28);1-4H;/q-2;-1;+1 |
| InChIKey | HIMLDRHTRPPHTB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|