C18H22N2O3 — CID 178178248
methanamine;2-(3-phenoxyphenyl)-1,4-oxazepan-3-one (PubChem CID 178178248) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is methanamine;2-(3-phenoxyphenyl)-1,4-oxazepan-3-one.
| Compound Name | methanamine;2-(3-phenoxyphenyl)-1,4-oxazepan-3-one |
|---|---|
| PubChem CID | 178178248 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | methanamine;2-(3-phenoxyphenyl)-1,4-oxazepan-3-one |
| SMILES | CN.O=C1NCCCOC1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C17H17NO3.CH5N/c19-17-16(20-11-5-10-18-17)13-6-4-9-15(12-13)21-14-7-2-1-3-8-14;1-2/h1-4,6-9,12,16H,5,10-11H2,(H,18,19);2H2,1H3 |
| InChIKey | DPXNOAVMZCQWDL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |