C18H23Cl3N4O4 — CID 178181740
tert-butyl N-[3-(1-chlorocyclopropyl)-4-pyridinyl]carbamate;1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 178181740) has the molecular formula C18H23Cl3N4O4 and a molecular weight of 465.77 g/mol. Its IUPAC name is tert-butyl N-[3-(1-chlorocyclopropyl)-4-pyridinyl]carbamate;1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | tert-butyl N-[3-(1-chlorocyclopropyl)-4-pyridinyl]carbamate;1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 178181740 |
| Molecular Formula | C18H23Cl3N4O4 |
| Molecular Weight | 465.77 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | tert-butyl N-[3-(1-chlorocyclopropyl)-4-pyridinyl]carbamate;1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)OC(=O)Nc1ccncc1C1(Cl)CC1.CC1(C)C(=O)N(Cl)C(=O)N1Cl |
| InChI | InChI=1S/C13H17ClN2O2.C5H6Cl2N2O2/c1-12(2,3)18-11(17)16-10-4-7-15-8-9(10)13(14)5-6-13;1-5(2)3(10)8(6)4(11)9(5)7/h4,7-8H,5-6H2,1-3H3,(H,15,16,17);1-2H3 |
| InChIKey | JSJWYSPORAKUTI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.77 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|