C22H44F9N2O3P — CID 178182662
fluoro-dioxido-oxo-λ5-phosphane;bis(triethyl(4,4,5,5-tetrafluoropentyl)azanium) (PubChem CID 178182662) has the molecular formula C22H44F9N2O3P and a molecular weight of 586.56 g/mol. Its IUPAC name is fluoro-dioxido-oxo-λ5-phosphane;bis(triethyl(4,4,5,5-tetrafluoropentyl)azanium).
| Compound Name | fluoro-dioxido-oxo-λ5-phosphane;bis(triethyl(4,4,5,5-tetrafluoropentyl)azanium) |
|---|---|
| PubChem CID | 178182662 |
| Molecular Formula | C22H44F9N2O3P |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | fluoro-dioxido-oxo-λ5-phosphane;bis(triethyl(4,4,5,5-tetrafluoropentyl)azanium) |
| SMILES | CC[N+](CC)(CC)CCCC(F)(F)C(F)F.CC[N+](CC)(CC)CCCC(F)(F)C(F)F.O=P([O-])([O-])F |
| InChI | InChI=1S/2C11H22F4N.FH2O3P/c2*1-4-16(5-2,6-3)9-7-8-11(14,15)10(12)13;1-5(2,3)4/h2*10H,4-9H2,1-3H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | UIFVGAUZUYPZHQ-UHFFFAOYSA-L |
| XLogP | 5.87 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|