C14H16N2O3S2 — CID 178186267
(5Z)-2-(1,3-dihydroxypropan-2-ylimino)-5-[(4-methylsulfanylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 178186267) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is (5Z)-2-(1,3-dihydroxypropan-2-ylimino)-5-[(4-methylsulfanylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(1,3-dihydroxypropan-2-ylimino)-5-[(4-methylsulfanylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 178186267 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (5Z)-2-(1,3-dihydroxypropan-2-ylimino)-5-[(4-methylsulfanylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CSc1ccc(/C=C2\S/C(=N/C(CO)CO)NC2=O)cc1 |
| InChI | InChI=1S/C14H16N2O3S2/c1-20-11-4-2-9(3-5-11)6-12-13(19)16-14(21-12)15-10(7-17)8-18/h2-6,10,17-18H,7-8H2,1H3,(H,15,16,19)/b12-6- |
| InChIKey | SQTVMTKFLBDZGX-SDQBBNPISA-N |
| XLogP | 1.32 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|