C21H19N3O3S — CID 135454864
(5E)-2-(1-hydroxy-3-phenylpropan-2-yl)imino-5-[(2-methyl-1,3-benzoxazol-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135454864) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is (5E)-2-(1-hydroxy-3-phenylpropan-2-yl)imino-5-[(2-methyl-1,3-benzoxazol-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(1-hydroxy-3-phenylpropan-2-yl)imino-5-[(2-methyl-1,3-benzoxazol-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135454864 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (5E)-2-(1-hydroxy-3-phenylpropan-2-yl)imino-5-[(2-methyl-1,3-benzoxazol-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1nc2ccc(/C=C3/S/C(=N\C(CO)Cc4ccccc4)NC3=O)cc2o1 |
| InChI | InChI=1S/C21H19N3O3S/c1-13-22-17-8-7-15(10-18(17)27-13)11-19-20(26)24-21(28-19)23-16(12-25)9-14-5-3-2-4-6-14/h2-8,10-11,16,25H,9,12H2,1H3,(H,23,24,26)/b19-11+ |
| InChIKey | FKCJKALFUYWHPF-YBFXNURJSA-N |
| XLogP | 3.30 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|