C21H17N3O4S — CID 135514439
(5E)-2-[2-(1,3-benzodioxol-5-yl)ethylimino]-5-[(2-methyl-1,3-benzoxazol-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135514439) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is (5E)-2-[2-(1,3-benzodioxol-5-yl)ethylimino]-5-[(2-methyl-1,3-benzoxazol-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-[2-(1,3-benzodioxol-5-yl)ethylimino]-5-[(2-methyl-1,3-benzoxazol-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135514439 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (5E)-2-[2-(1,3-benzodioxol-5-yl)ethylimino]-5-[(2-methyl-1,3-benzoxazol-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1nc2ccc(/C=C3/S/C(=N\CCc4ccc5c(c4)OCO5)NC3=O)cc2o1 |
| InChI | InChI=1S/C21H17N3O4S/c1-12-23-15-4-2-14(9-17(15)28-12)10-19-20(25)24-21(29-19)22-7-6-13-3-5-16-18(8-13)27-11-26-16/h2-5,8-10H,6-7,11H2,1H3,(H,22,24,25)/b19-10+ |
| InChIKey | SIZHMRRBKDQCGM-VXLYETTFSA-N |
| XLogP | 3.67 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|