C18H15N3O4S — CID 18007459
(5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yl) 4-cyanobenzoate (PubChem CID 18007459) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is (5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yl) 4-cyanobenzoate.
| Compound Name | (5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yl) 4-cyanobenzoate |
|---|---|
| PubChem CID | 18007459 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (5,5-dioxo-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yl) 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)Oc2ccc3c(c2)S(=O)(=O)NC2CCCN32)cc1 |
| InChI | InChI=1S/C18H15N3O4S/c19-11-12-3-5-13(6-4-12)18(22)25-14-7-8-15-16(10-14)26(23,24)20-17-2-1-9-21(15)17/h3-8,10,17,20H,1-2,9H2 |
| InChIKey | SRLWQJZIOACUFN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|