C17H16N2O4S — CID 67529778
phenyl 4-cyclopropyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazine-7-carboxylate (PubChem CID 67529778) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is phenyl 4-cyclopropyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazine-7-carboxylate.
| Compound Name | phenyl 4-cyclopropyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 67529778 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | phenyl 4-cyclopropyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazine-7-carboxylate |
| SMILES | O=C(Oc1ccccc1)c1ccc2c(c1)S(=O)(=O)NCN2C1CC1 |
| InChI | InChI=1S/C17H16N2O4S/c20-17(23-14-4-2-1-3-5-14)12-6-9-15-16(10-12)24(21,22)18-11-19(15)13-7-8-13/h1-6,9-10,13,18H,7-8,11H2 |
| InChIKey | UEZGYPMHSBKYTF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|