C17H18N2O5S — CID 90667509
(3-methoxyphenyl) 4-ethyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazine-7-carboxylate (PubChem CID 90667509) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is (3-methoxyphenyl) 4-ethyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazine-7-carboxylate.
| Compound Name | (3-methoxyphenyl) 4-ethyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 90667509 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (3-methoxyphenyl) 4-ethyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazine-7-carboxylate |
| SMILES | CCN1CNS(=O)(=O)c2cc(C(=O)Oc3cccc(OC)c3)ccc21 |
| InChI | InChI=1S/C17H18N2O5S/c1-3-19-11-18-25(21,22)16-9-12(7-8-15(16)19)17(20)24-14-6-4-5-13(10-14)23-2/h4-10,18H,3,11H2,1-2H3 |
| InChIKey | NNBIWEDCRPAOGY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|