C22H40O8-2 — CID 18008180
2,2-bis(1-butoxy-1-ethoxyethyl)hexanedioate (PubChem CID 18008180) has the molecular formula C22H40O8-2 and a molecular weight of 432.55 g/mol. Its IUPAC name is 2,2-bis(1-butoxy-1-ethoxyethyl)hexanedioate.
| Compound Name | 2,2-bis(1-butoxy-1-ethoxyethyl)hexanedioate |
|---|---|
| PubChem CID | 18008180 |
| Molecular Formula | C22H40O8-2 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 2,2-bis(1-butoxy-1-ethoxyethyl)hexanedioate |
| SMILES | CCCCOC(C)(OCC)C(CCCC(=O)[O-])(C(=O)[O-])C(C)(OCC)OCCCC |
| InChI | InChI=1S/C22H42O8/c1-7-11-16-29-20(5,27-9-3)22(19(25)26,15-13-14-18(23)24)21(6,28-10-4)30-17-12-8-2/h7-17H2,1-6H3,(H,23,24)(H,25,26)/p-2 |
| InChIKey | BVZAZMIWCLRCGY-UHFFFAOYSA-L |
| XLogP | 1.78 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|