C12H14NO7P — CID 18009250
[2-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-oxoethyl] dihydrogen phosphate (PubChem CID 18009250) has the molecular formula C12H14NO7P and a molecular weight of 315.22 g/mol. Its IUPAC name is [2-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-oxoethyl] dihydrogen phosphate.
| Compound Name | [2-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-oxoethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18009250 |
| Molecular Formula | C12H14NO7P |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | [2-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-oxoethyl] dihydrogen phosphate |
| SMILES | O=C(COP(=O)(O)O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C12H14NO7P/c14-11(8-20-21(16,17)18)13-10(7-19-12(13)15)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,16,17,18) |
| InChIKey | ZNNYHSTYGBCSDW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|