C25H39N3O4 — CID 18010557
tert-butyl N-[1-[[1-(2-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18010557) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18010557 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccccc1C |
| InChI | InChI=1S/C25H39N3O4/c1-8-10-13-16-26-22(29)21(20-15-12-11-14-18(20)3)28(17-9-2)23(30)19(4)27-24(31)32-25(5,6)7/h9,11-12,14-15,19,21H,2,8,10,13,16-17H2,1,3-7H3,(H,26,29)(H,27,31) |
| InChIKey | NTALZFIUAJSIQW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|