C19H25N3O4 — CID 18074159
3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 18074159) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18074159 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-5-methyl-1-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)N(CC(=O)N3CC(C)OC(C)C3)C(=O)C2C)cc1 |
| InChI | InChI=1S/C19H25N3O4/c1-12-5-7-16(8-6-12)22-15(4)18(24)21(19(22)25)11-17(23)20-9-13(2)26-14(3)10-20/h5-8,13-15H,9-11H2,1-4H3 |
| InChIKey | IMJPQFASJWKEAF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|