C19H19Cl2N5O3 — CID 18096353
N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide (PubChem CID 18096353) has the molecular formula C19H19Cl2N5O3 and a molecular weight of 436.30 g/mol. Its IUPAC name is N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide.
| Compound Name | N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
|---|---|
| PubChem CID | 18096353 |
| Molecular Formula | C19H19Cl2N5O3 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-[2-[(2,3-dichlorophenyl)methyl]pyrazol-3-yl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)Nc1ccnn1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H19Cl2N5O3/c20-13-5-3-4-12(16(13)21)10-26-14(6-9-22-26)23-15(27)11-25-17(28)19(24-18(25)29)7-1-2-8-19/h3-6,9H,1-2,7-8,10-11H2,(H,23,27)(H,24,29) |
| InChIKey | UGLIEVWVKWEYSR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|