C16H19N3O4 — CID 18099885
1-[2-(cyclohexen-1-yl)ethyl]-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 18099885) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 18099885 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(3-methyl-1,2-oxazol-5-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | Cc1cc(CN2C(=O)C(=O)N(CCC3=CCCCC3)C2=O)on1 |
| InChI | InChI=1S/C16H19N3O4/c1-11-9-13(23-17-11)10-19-15(21)14(20)18(16(19)22)8-7-12-5-3-2-4-6-12/h5,9H,2-4,6-8,10H2,1H3 |
| InChIKey | XZYMDYUABYJZGG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|