C15H19N3O3S — CID 18106389
2,4-dimethyl-N'-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]benzohydrazide (PubChem CID 18106389) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2,4-dimethyl-N'-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]benzohydrazide.
| Compound Name | 2,4-dimethyl-N'-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 18106389 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2,4-dimethyl-N'-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]benzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CCN2CCSC2=O)c(C)c1 |
| InChI | InChI=1S/C15H19N3O3S/c1-10-3-4-12(11(2)9-10)14(20)17-16-13(19)5-6-18-7-8-22-15(18)21/h3-4,9H,5-8H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | AYIYZAZACDHTKZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|