C18H16N4O4S — CID 18107755
N'-[2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetyl]thiophene-2-carbohydrazide (PubChem CID 18107755) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is N'-[2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 18107755 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N'-[2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CN1C(=O)NC2(CCc3ccccc32)C1=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C18H16N4O4S/c23-14(20-21-15(24)13-6-3-9-27-13)10-22-16(25)18(19-17(22)26)8-7-11-4-1-2-5-12(11)18/h1-6,9H,7-8,10H2,(H,19,26)(H,20,23)(H,21,24) |
| InChIKey | WOKKWKWWVSLGEU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|