C18H19F3N2O2S — CID 18112770
N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-4-thiophen-2-ylbutanamide (PubChem CID 18112770) has the molecular formula C18H19F3N2O2S and a molecular weight of 384.42 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 18112770 |
| Molecular Formula | C18H19F3N2O2S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-4-thiophen-2-ylbutanamide |
| SMILES | CN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)CCCc1cccs1 |
| InChI | InChI=1S/C18H19F3N2O2S/c1-23(17(25)10-4-6-13-7-5-11-26-13)12-16(24)22-15-9-3-2-8-14(15)18(19,20)21/h2-3,5,7-9,11H,4,6,10,12H2,1H3,(H,22,24) |
| InChIKey | LEPOZQPATJVLNM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |