C20H14N2O2S — CID 18130482
3-(quinolin-8-ylmethyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 18130482) has the molecular formula C20H14N2O2S and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-(quinolin-8-ylmethyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-(quinolin-8-ylmethyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 18130482 |
| Molecular Formula | C20H14N2O2S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-(quinolin-8-ylmethyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1Cc1cccc2cccnc12 |
| InChI | InChI=1S/C20H14N2O2S/c23-25(24)18-11-3-6-14-5-2-10-17(19(14)18)22(25)13-16-8-1-7-15-9-4-12-21-20(15)16/h1-12H,13H2 |
| InChIKey | KAZGKXSCCUPWIM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |