C18H22N2OS — CID 18165907
4-(1,3-benzothiazol-2-yl)-N-(3-ethylpent-1-yn-3-yl)butanamide (PubChem CID 18165907) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-(3-ethylpent-1-yn-3-yl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-(3-ethylpent-1-yn-3-yl)butanamide |
|---|---|
| PubChem CID | 18165907 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-(3-ethylpent-1-yn-3-yl)butanamide |
| SMILES | C#CC(CC)(CC)NC(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H22N2OS/c1-4-18(5-2,6-3)20-16(21)12-9-13-17-19-14-10-7-8-11-15(14)22-17/h1,7-8,10-11H,5-6,9,12-13H2,2-3H3,(H,20,21) |
| InChIKey | BDJJPQQRYJWXFJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|