C31H32O2P2 — CID 18172358
1,2-bis(diphenylphosphanylmethyl)-3,3-dimethylcyclopropane-1,2-diol (PubChem CID 18172358) has the molecular formula C31H32O2P2 and a molecular weight of 498.54 g/mol. Its IUPAC name is 1,2-bis(diphenylphosphanylmethyl)-3,3-dimethylcyclopropane-1,2-diol.
| Compound Name | 1,2-bis(diphenylphosphanylmethyl)-3,3-dimethylcyclopropane-1,2-diol |
|---|---|
| PubChem CID | 18172358 |
| Molecular Formula | C31H32O2P2 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 1,2-bis(diphenylphosphanylmethyl)-3,3-dimethylcyclopropane-1,2-diol |
| SMILES | CC1(C)C(O)(CP(c2ccccc2)c2ccccc2)C1(O)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32O2P2/c1-29(2)30(32,23-34(25-15-7-3-8-16-25)26-17-9-4-10-18-26)31(29,33)24-35(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,32-33H,23-24H2,1-2H3 |
| InChIKey | QYHSKGUSFQQZAW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|