C33H36O2P2 — CID 58555952
[(4S,5S)-5-(diphenylphosphanylmethyl)-2,2,4,5-tetramethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane (PubChem CID 58555952) has the molecular formula C33H36O2P2 and a molecular weight of 526.60 g/mol. Its IUPAC name is [(4S,5S)-5-(diphenylphosphanylmethyl)-2,2,4,5-tetramethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane.
| Compound Name | [(4S,5S)-5-(diphenylphosphanylmethyl)-2,2,4,5-tetramethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 58555952 |
| Molecular Formula | C33H36O2P2 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | [(4S,5S)-5-(diphenylphosphanylmethyl)-2,2,4,5-tetramethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane |
| SMILES | CC1(C)O[C@](C)(CP(c2ccccc2)c2ccccc2)[C@@](C)(CP(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C33H36O2P2/c1-31(2)34-32(3,25-36(27-17-9-5-10-18-27)28-19-11-6-12-20-28)33(4,35-31)26-37(29-21-13-7-14-22-29)30-23-15-8-16-24-30/h5-24H,25-26H2,1-4H3/t32-,33-/m1/s1 |
| InChIKey | NVWQECBTWCUFSL-CZNDPXEESA-N |
| XLogP | 6.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|