C25H31P — CID 101105059
3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)propyl-diphenylphosphane (PubChem CID 101105059) has the molecular formula C25H31P and a molecular weight of 362.50 g/mol. Its IUPAC name is 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)propyl-diphenylphosphane.
| Compound Name | 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)propyl-diphenylphosphane |
|---|---|
| PubChem CID | 101105059 |
| Molecular Formula | C25H31P |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)propyl-diphenylphosphane |
| SMILES | CC1=C(C)C(C)(CCCP(c2ccccc2)c2ccccc2)C(C)=C1C |
| InChI | InChI=1S/C25H31P/c1-19-20(2)22(4)25(5,21(19)3)17-12-18-26(23-13-8-6-9-14-23)24-15-10-7-11-16-24/h6-11,13-16H,12,17-18H2,1-5H3 |
| InChIKey | GDFUZEMEWBQYDF-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|