C16H11ClF4O2S — CID 18175454
1-(4-chlorophenyl)-2-(2,2,3,3-tetrafluoropropyl)-3-thiophen-2-ylpropane-1,3-dione (PubChem CID 18175454) has the molecular formula C16H11ClF4O2S and a molecular weight of 378.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2,2,3,3-tetrafluoropropyl)-3-thiophen-2-ylpropane-1,3-dione.
| Compound Name | 1-(4-chlorophenyl)-2-(2,2,3,3-tetrafluoropropyl)-3-thiophen-2-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 18175454 |
| Molecular Formula | C16H11ClF4O2S |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2,2,3,3-tetrafluoropropyl)-3-thiophen-2-ylpropane-1,3-dione |
| SMILES | O=C(c1ccc(Cl)cc1)C(CC(F)(F)C(F)F)C(=O)c1cccs1 |
| InChI | InChI=1S/C16H11ClF4O2S/c17-10-5-3-9(4-6-10)13(22)11(8-16(20,21)15(18)19)14(23)12-2-1-7-24-12/h1-7,11,15H,8H2 |
| InChIKey | GKZCNBCRYGXKHQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|