C23H28O2 — CID 18177880
2-phenylmethoxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetaldehyde (PubChem CID 18177880) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-phenylmethoxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetaldehyde.
| Compound Name | 2-phenylmethoxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 18177880 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-phenylmethoxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetaldehyde |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(C=O)OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C23H28O2/c1-22(2)12-13-23(3,4)20-14-18(10-11-19(20)22)21(15-24)25-16-17-8-6-5-7-9-17/h5-11,14-15,21H,12-13,16H2,1-4H3 |
| InChIKey | BGMUDXYGPCAYMM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|