C22H25N3O4 — CID 18182554
N-[2-(5-carbamimidoyl-2,3-dihydro-1-benzofuran-3-yl)ethyl]-2-(4-methoxyphenyl)-4-oxobutanamide (PubChem CID 18182554) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[2-(5-carbamimidoyl-2,3-dihydro-1-benzofuran-3-yl)ethyl]-2-(4-methoxyphenyl)-4-oxobutanamide.
| Compound Name | N-[2-(5-carbamimidoyl-2,3-dihydro-1-benzofuran-3-yl)ethyl]-2-(4-methoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 18182554 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[2-(5-carbamimidoyl-2,3-dihydro-1-benzofuran-3-yl)ethyl]-2-(4-methoxyphenyl)-4-oxobutanamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C(CCNC(=O)C(CC=O)c1ccc(OC)cc1)CO2 |
| InChI | InChI=1S/C22H25N3O4/c1-28-17-5-2-14(3-6-17)18(9-11-26)22(27)25-10-8-16-13-29-20-7-4-15(21(23)24)12-19(16)20/h2-7,11-12,16,18H,8-10,13H2,1H3,(H3,23,24)(H,25,27) |
| InChIKey | MEGZLHDWKJPNFM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|