C20H23N3O2 — CID 90956032
N-[2-(5-carbamimidoyl-2,3-dihydro-1-benzofuran-3-yl)ethyl]-3-phenylpropanamide (PubChem CID 90956032) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[2-(5-carbamimidoyl-2,3-dihydro-1-benzofuran-3-yl)ethyl]-3-phenylpropanamide.
| Compound Name | N-[2-(5-carbamimidoyl-2,3-dihydro-1-benzofuran-3-yl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 90956032 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[2-(5-carbamimidoyl-2,3-dihydro-1-benzofuran-3-yl)ethyl]-3-phenylpropanamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C(CCNC(=O)CCc1ccccc1)CO2 |
| InChI | InChI=1S/C20H23N3O2/c21-20(22)15-7-8-18-17(12-15)16(13-25-18)10-11-23-19(24)9-6-14-4-2-1-3-5-14/h1-5,7-8,12,16H,6,9-11,13H2,(H3,21,22)(H,23,24) |
| InChIKey | LRXPAJQGVBQMAU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|